C18H15Cl2F3N6O2 — CID 170344679
6,7-dichloro-1-methyl-4-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]pyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 170344679) has the molecular formula C18H15Cl2F3N6O2 and a molecular weight of 475.26 g/mol. Its IUPAC name is 6,7-dichloro-1-methyl-4-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]pyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 6,7-dichloro-1-methyl-4-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]pyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 170344679 |
| Molecular Formula | C18H15Cl2F3N6O2 |
| Molecular Weight | 475.26 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 6,7-dichloro-1-methyl-4-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]pyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | Cn1c(=O)c(=O)n(C2CCN(c3ncc(C(F)(F)F)cn3)CC2)c2nc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C18H15Cl2F3N6O2/c1-27-12-6-11(19)13(20)26-14(12)29(16(31)15(27)30)10-2-4-28(5-3-10)17-24-7-9(8-25-17)18(21,22)23/h6-8,10H,2-5H2,1H3 |
| InChIKey | ZQLXXJAJVAXHLM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 85.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|