C18H16Cl2N6O3 — CID 170347633
7-chloro-4-[1-(5-chloropyrimidine-2-carbonyl)piperidin-4-yl]-1-methylpyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 170347633) has the molecular formula C18H16Cl2N6O3 and a molecular weight of 435.27 g/mol. Its IUPAC name is 7-chloro-4-[1-(5-chloropyrimidine-2-carbonyl)piperidin-4-yl]-1-methylpyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 7-chloro-4-[1-(5-chloropyrimidine-2-carbonyl)piperidin-4-yl]-1-methylpyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 170347633 |
| Molecular Formula | C18H16Cl2N6O3 |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 7-chloro-4-[1-(5-chloropyrimidine-2-carbonyl)piperidin-4-yl]-1-methylpyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | Cn1c(=O)c(=O)n(C2CCN(C(=O)c3ncc(Cl)cn3)CC2)c2ncc(Cl)cc21 |
| InChI | InChI=1S/C18H16Cl2N6O3/c1-24-13-6-10(19)7-23-15(13)26(18(29)17(24)28)12-2-4-25(5-3-12)16(27)14-21-8-11(20)9-22-14/h6-9,12H,2-5H2,1H3 |
| InChIKey | DXMNQHAXAKFKDM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 102.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|