C21H21Cl2N5O3 — CID 170347486
4-(7-chloro-1-methyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)-N-[(4-chlorophenyl)methyl]piperidine-1-carboxamide (PubChem CID 170347486) has the molecular formula C21H21Cl2N5O3 and a molecular weight of 462.34 g/mol. Its IUPAC name is 4-(7-chloro-1-methyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)-N-[(4-chlorophenyl)methyl]piperidine-1-carboxamide.
| Compound Name | 4-(7-chloro-1-methyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)-N-[(4-chlorophenyl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 170347486 |
| Molecular Formula | C21H21Cl2N5O3 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 4-(7-chloro-1-methyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)-N-[(4-chlorophenyl)methyl]piperidine-1-carboxamide |
| SMILES | Cn1c(=O)c(=O)n(C2CCN(C(=O)NCc3ccc(Cl)cc3)CC2)c2ncc(Cl)cc21 |
| InChI | InChI=1S/C21H21Cl2N5O3/c1-26-17-10-15(23)12-24-18(17)28(20(30)19(26)29)16-6-8-27(9-7-16)21(31)25-11-13-2-4-14(22)5-3-13/h2-5,10,12,16H,6-9,11H2,1H3,(H,25,31) |
| InChIKey | WNQFIIUUHHCPBG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|