C24H25F3N4O3 — CID 163381763
7-cyclopropyl-1-methyl-4-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]pyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 163381763) has the molecular formula C24H25F3N4O3 and a molecular weight of 474.48 g/mol. Its IUPAC name is 7-cyclopropyl-1-methyl-4-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]pyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 7-cyclopropyl-1-methyl-4-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]pyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 163381763 |
| Molecular Formula | C24H25F3N4O3 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 7-cyclopropyl-1-methyl-4-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]pyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | Cn1c(=O)c(=O)n(C2CCN(Cc3ccc(OC(F)(F)F)cc3)CC2)c2ncc(C3CC3)cc21 |
| InChI | InChI=1S/C24H25F3N4O3/c1-29-20-12-17(16-4-5-16)13-28-21(20)31(23(33)22(29)32)18-8-10-30(11-9-18)14-15-2-6-19(7-3-15)34-24(25,26)27/h2-3,6-7,12-13,16,18H,4-5,8-11,14H2,1H3 |
| InChIKey | LRTMUFIIFPBXDY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|