C19H21BF3NO3 — CID 68627108
[4-[[4-[4-(trifluoromethoxy)phenyl]piperidin-1-yl]methyl]phenyl]boronic acid (PubChem CID 68627108) has the molecular formula C19H21BF3NO3 and a molecular weight of 379.19 g/mol. Its IUPAC name is [4-[[4-[4-(trifluoromethoxy)phenyl]piperidin-1-yl]methyl]phenyl]boronic acid.
| Compound Name | [4-[[4-[4-(trifluoromethoxy)phenyl]piperidin-1-yl]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 68627108 |
| Molecular Formula | C19H21BF3NO3 |
| Molecular Weight | 379.19 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | [4-[[4-[4-(trifluoromethoxy)phenyl]piperidin-1-yl]methyl]phenyl]boronic acid |
| SMILES | OB(O)c1ccc(CN2CCC(c3ccc(OC(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C19H21BF3NO3/c21-19(22,23)27-18-7-3-15(4-8-18)16-9-11-24(12-10-16)13-14-1-5-17(6-2-14)20(25)26/h1-8,16,25-26H,9-13H2 |
| InChIKey | QBGBAZYIKIKAHQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|