C13H18BF3N2O2 — CID 62966668
[4-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]boronic acid (PubChem CID 62966668) has the molecular formula C13H18BF3N2O2 and a molecular weight of 302.10 g/mol. Its IUPAC name is [4-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]boronic acid.
| Compound Name | [4-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 62966668 |
| Molecular Formula | C13H18BF3N2O2 |
| Molecular Weight | 302.10 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | [4-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]boronic acid |
| SMILES | OB(O)c1ccc(CN2CCN(CC(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C13H18BF3N2O2/c15-13(16,17)10-19-7-5-18(6-8-19)9-11-1-3-12(4-2-11)14(20)21/h1-4,20-21H,5-10H2 |
| InChIKey | FCSQTCARLWMZJX-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.10 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|