C22H26ClN5O2 — CID 170344718
7-chloro-4-[1-[4-[(dimethylamino)methyl]phenyl]piperidin-4-yl]-1-methylpyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 170344718) has the molecular formula C22H26ClN5O2 and a molecular weight of 427.94 g/mol. Its IUPAC name is 7-chloro-4-[1-[4-[(dimethylamino)methyl]phenyl]piperidin-4-yl]-1-methylpyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 7-chloro-4-[1-[4-[(dimethylamino)methyl]phenyl]piperidin-4-yl]-1-methylpyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 170344718 |
| Molecular Formula | C22H26ClN5O2 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 7-chloro-4-[1-[4-[(dimethylamino)methyl]phenyl]piperidin-4-yl]-1-methylpyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | CN(C)Cc1ccc(N2CCC(n3c(=O)c(=O)n(C)c4cc(Cl)cnc43)CC2)cc1 |
| InChI | InChI=1S/C22H26ClN5O2/c1-25(2)14-15-4-6-17(7-5-15)27-10-8-18(9-11-27)28-20-19(12-16(23)13-24-20)26(3)21(29)22(28)30/h4-7,12-13,18H,8-11,14H2,1-3H3 |
| InChIKey | BQQOWQTYYKOWIF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|