C15H17ClN4O2 — CID 163381835
4-(8-azabicyclo[3.2.1]octan-3-yl)-7-chloro-1-methylpyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 163381835) has the molecular formula C15H17ClN4O2 and a molecular weight of 320.78 g/mol. Its IUPAC name is 4-(8-azabicyclo[3.2.1]octan-3-yl)-7-chloro-1-methylpyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 4-(8-azabicyclo[3.2.1]octan-3-yl)-7-chloro-1-methylpyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 163381835 |
| Molecular Formula | C15H17ClN4O2 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 4-(8-azabicyclo[3.2.1]octan-3-yl)-7-chloro-1-methylpyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | Cn1c(=O)c(=O)n(C2CC3CCC(C2)N3)c2ncc(Cl)cc21 |
| InChI | InChI=1S/C15H17ClN4O2/c1-19-12-4-8(16)7-17-13(12)20(15(22)14(19)21)11-5-9-2-3-10(6-11)18-9/h4,7,9-11,18H,2-3,5-6H2,1H3 |
| InChIKey | LDMWICAYGCZMMA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|