C13H17Cl2FN4O2 — CID 169081128
7-fluoro-1-methyl-4-piperidin-4-ylpyrido[2,3-b]pyrazine-2,3-dione;dihydrochloride (PubChem CID 169081128) has the molecular formula C13H17Cl2FN4O2 and a molecular weight of 351.21 g/mol. Its IUPAC name is 7-fluoro-1-methyl-4-piperidin-4-ylpyrido[2,3-b]pyrazine-2,3-dione;dihydrochloride.
| Compound Name | 7-fluoro-1-methyl-4-piperidin-4-ylpyrido[2,3-b]pyrazine-2,3-dione;dihydrochloride |
|---|---|
| PubChem CID | 169081128 |
| Molecular Formula | C13H17Cl2FN4O2 |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 7-fluoro-1-methyl-4-piperidin-4-ylpyrido[2,3-b]pyrazine-2,3-dione;dihydrochloride |
| SMILES | Cl.Cl.Cn1c(=O)c(=O)n(C2CCNCC2)c2ncc(F)cc21 |
| InChI | InChI=1S/C13H15FN4O2.2ClH/c1-17-10-6-8(14)7-16-11(10)18(13(20)12(17)19)9-2-4-15-5-3-9;;/h6-7,9,15H,2-5H2,1H3;2*1H |
| InChIKey | KMGZGHANIKRRAK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|