C12H13FN4O2 — CID 169094250
7-fluoro-4-piperidin-4-yl-1H-pyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 169094250) has the molecular formula C12H13FN4O2 and a molecular weight of 264.26 g/mol. Its IUPAC name is 7-fluoro-4-piperidin-4-yl-1H-pyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 7-fluoro-4-piperidin-4-yl-1H-pyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 169094250 |
| Molecular Formula | C12H13FN4O2 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 7-fluoro-4-piperidin-4-yl-1H-pyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | O=c1[nH]c2cc(F)cnc2n(C2CCNCC2)c1=O |
| InChI | InChI=1S/C12H13FN4O2/c13-7-5-9-10(15-6-7)17(12(19)11(18)16-9)8-1-3-14-4-2-8/h5-6,8,14H,1-4H2,(H,16,18) |
| InChIKey | DTODLDJXZULUDN-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|