C36H34Cl2N4O — CID 126616457
N-benzyl-4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidine-1-carboxamide (PubChem CID 126616457) has the molecular formula C36H34Cl2N4O and a molecular weight of 609.60 g/mol. Its IUPAC name is N-benzyl-4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidine-1-carboxamide.
| Compound Name | N-benzyl-4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126616457 |
| Molecular Formula | C36H34Cl2N4O |
| Molecular Weight | 609.60 g/mol |
| Exact Mass | 608.21 |
| IUPAC Name | N-benzyl-4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCC(n2c(C3CC3)nc3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc32)CC1 |
| InChI | InChI=1S/C36H34Cl2N4O/c37-29-13-8-25(9-14-29)34(26-10-15-30(38)16-11-26)28-12-17-32-33(22-28)42(35(40-32)27-6-7-27)31-18-20-41(21-19-31)36(43)39-23-24-4-2-1-3-5-24/h1-5,8-17,22,27,31,34H,6-7,18-21,23H2,(H,39,43) |
| InChIKey | SEWHRBGVYGUQOI-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.60 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|