C35H33Cl2N3O3S — CID 126616429
6-[bis(4-chlorophenyl)methyl]-2-cyclopropyl-1-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]benzimidazole (PubChem CID 126616429) has the molecular formula C35H33Cl2N3O3S and a molecular weight of 646.64 g/mol. Its IUPAC name is 6-[bis(4-chlorophenyl)methyl]-2-cyclopropyl-1-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]benzimidazole.
| Compound Name | 6-[bis(4-chlorophenyl)methyl]-2-cyclopropyl-1-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]benzimidazole |
|---|---|
| PubChem CID | 126616429 |
| Molecular Formula | C35H33Cl2N3O3S |
| Molecular Weight | 646.64 g/mol |
| Exact Mass | 645.16 |
| IUPAC Name | 6-[bis(4-chlorophenyl)methyl]-2-cyclopropyl-1-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]benzimidazole |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(n3c(C4CC4)nc4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc43)CC2)cc1 |
| InChI | InChI=1S/C35H33Cl2N3O3S/c1-43-30-13-15-31(16-14-30)44(41,42)39-20-18-29(19-21-39)40-33-22-26(8-17-32(33)38-35(40)25-2-3-25)34(23-4-9-27(36)10-5-23)24-6-11-28(37)12-7-24/h4-17,22,25,29,34H,2-3,18-21H2,1H3 |
| InChIKey | YALGUOFNCWRMTQ-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.64 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|