C34H33Cl3N4OS — CID 126616404
5-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]thiophene-3-carboxamide;hydrochloride (PubChem CID 126616404) has the molecular formula C34H33Cl3N4OS and a molecular weight of 652.09 g/mol. Its IUPAC name is 5-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]thiophene-3-carboxamide;hydrochloride.
| Compound Name | 5-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]thiophene-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 126616404 |
| Molecular Formula | C34H33Cl3N4OS |
| Molecular Weight | 652.09 g/mol |
| Exact Mass | 650.14 |
| IUPAC Name | 5-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]thiophene-3-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)c1csc(CN2CCC(n3c(C4CC4)nc4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc43)CC2)c1 |
| InChI | InChI=1S/C34H32Cl2N4OS.ClH/c35-26-8-3-21(4-9-26)32(22-5-10-27(36)11-6-22)24-7-12-30-31(18-24)40(34(38-30)23-1-2-23)28-13-15-39(16-14-28)19-29-17-25(20-42-29)33(37)41;/h3-12,17-18,20,23,28,32H,1-2,13-16,19H2,(H2,37,41);1H |
| InChIKey | FDSVANUBURAPNW-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.09 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|