C37H31Cl2F3N4O3 — CID 126642696
[2-[6-[bis(4-chlorophenyl)methyl]-1-[1-(4-carbamoylphenyl)piperidin-4-yl]benzimidazol-2-yl]cyclopropyl] 2,2,2-trifluoroacetate (PubChem CID 126642696) has the molecular formula C37H31Cl2F3N4O3 and a molecular weight of 707.58 g/mol. Its IUPAC name is [2-[6-[bis(4-chlorophenyl)methyl]-1-[1-(4-carbamoylphenyl)piperidin-4-yl]benzimidazol-2-yl]cyclopropyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[6-[bis(4-chlorophenyl)methyl]-1-[1-(4-carbamoylphenyl)piperidin-4-yl]benzimidazol-2-yl]cyclopropyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 126642696 |
| Molecular Formula | C37H31Cl2F3N4O3 |
| Molecular Weight | 707.58 g/mol |
| Exact Mass | 706.17 |
| IUPAC Name | [2-[6-[bis(4-chlorophenyl)methyl]-1-[1-(4-carbamoylphenyl)piperidin-4-yl]benzimidazol-2-yl]cyclopropyl] 2,2,2-trifluoroacetate |
| SMILES | NC(=O)c1ccc(N2CCC(n3c(C4CC4OC(=O)C(F)(F)F)nc4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc43)CC2)cc1 |
| InChI | InChI=1S/C37H31Cl2F3N4O3/c38-25-8-1-21(2-9-25)33(22-3-10-26(39)11-4-22)24-7-14-30-31(19-24)46(35(44-30)29-20-32(29)49-36(48)37(40,41)42)28-15-17-45(18-16-28)27-12-5-23(6-13-27)34(43)47/h1-14,19,28-29,32-33H,15-18,20H2,(H2,43,47) |
| InChIKey | XWDDRSCOLLWLMT-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.58 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|