C37H32Cl2F3N3O2 — CID 126616230
[3-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]cyclohexyl]amino]phenyl] 2,2,2-trifluoroacetate (PubChem CID 126616230) has the molecular formula C37H32Cl2F3N3O2 and a molecular weight of 678.58 g/mol. Its IUPAC name is [3-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]cyclohexyl]amino]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]cyclohexyl]amino]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 126616230 |
| Molecular Formula | C37H32Cl2F3N3O2 |
| Molecular Weight | 678.58 g/mol |
| Exact Mass | 677.18 |
| IUPAC Name | [3-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]cyclohexyl]amino]phenyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1cccc(NC2CCC(n3c(C4CC4)nc4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc43)CC2)c1)C(F)(F)F |
| InChI | InChI=1S/C37H32Cl2F3N3O2/c38-26-11-6-22(7-12-26)34(23-8-13-27(39)14-9-23)25-10-19-32-33(20-25)45(35(44-32)24-4-5-24)30-17-15-28(16-18-30)43-29-2-1-3-31(21-29)47-36(46)37(40,41)42/h1-3,6-14,19-21,24,28,30,34,43H,4-5,15-18H2 |
| InChIKey | QNCNZESVUXRYRK-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.58 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|