C34H32Cl3N3O3 — CID 126616767
5-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]furan-2-carboxylic acid;hydrochloride (PubChem CID 126616767) has the molecular formula C34H32Cl3N3O3 and a molecular weight of 637.01 g/mol. Its IUPAC name is 5-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]furan-2-carboxylic acid;hydrochloride.
| Compound Name | 5-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]furan-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 126616767 |
| Molecular Formula | C34H32Cl3N3O3 |
| Molecular Weight | 637.01 g/mol |
| Exact Mass | 635.15 |
| IUPAC Name | 5-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]furan-2-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(CN2CCC(n3c(C4CC4)nc4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc43)CC2)o1 |
| InChI | InChI=1S/C34H31Cl2N3O3.ClH/c35-25-8-3-21(4-9-25)32(22-5-10-26(36)11-6-22)24-7-13-29-30(19-24)39(33(37-29)23-1-2-23)27-15-17-38(18-16-27)20-28-12-14-31(42-28)34(40)41;/h3-14,19,23,27,32H,1-2,15-18,20H2,(H,40,41);1H |
| InChIKey | BPQNMWSTDYGMDX-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.01 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|