C36H32Cl2FN3O2 — CID 126616448
3-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]-2-fluorobenzoic acid (PubChem CID 126616448) has the molecular formula C36H32Cl2FN3O2 and a molecular weight of 628.58 g/mol. Its IUPAC name is 3-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]-2-fluorobenzoic acid.
| Compound Name | 3-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 126616448 |
| Molecular Formula | C36H32Cl2FN3O2 |
| Molecular Weight | 628.58 g/mol |
| Exact Mass | 627.19 |
| IUPAC Name | 3-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1cccc(CN2CCC(n3c(C4CC4)nc4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc43)CC2)c1F |
| InChI | InChI=1S/C36H32Cl2FN3O2/c37-27-11-6-22(7-12-27)33(23-8-13-28(38)14-9-23)25-10-15-31-32(20-25)42(35(40-31)24-4-5-24)29-16-18-41(19-17-29)21-26-2-1-3-30(34(26)39)36(43)44/h1-3,6-15,20,24,29,33H,4-5,16-19,21H2,(H,43,44) |
| InChIKey | BAUVJTBPOFAUBX-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.58 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|