C29H23Cl3N2O — CID 126616932
3-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]phenol;hydrochloride (PubChem CID 126616932) has the molecular formula C29H23Cl3N2O and a molecular weight of 521.88 g/mol. Its IUPAC name is 3-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]phenol;hydrochloride.
| Compound Name | 3-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]phenol;hydrochloride |
|---|---|
| PubChem CID | 126616932 |
| Molecular Formula | C29H23Cl3N2O |
| Molecular Weight | 521.88 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | 3-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]phenol;hydrochloride |
| SMILES | Cl.Oc1cccc(-n2c(C3CC3)nc3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc32)c1 |
| InChI | InChI=1S/C29H22Cl2N2O.ClH/c30-22-11-6-18(7-12-22)28(19-8-13-23(31)14-9-19)21-10-15-26-27(16-21)33(29(32-26)20-4-5-20)24-2-1-3-25(34)17-24;/h1-3,6-17,20,28,34H,4-5H2;1H |
| InChIKey | OCEIZPLUHWRNPL-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.88 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|