C33H28Cl2N2O3 — CID 126616444
methyl 4-[2-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]ethoxy]benzoate (PubChem CID 126616444) has the molecular formula C33H28Cl2N2O3 and a molecular weight of 571.50 g/mol. Its IUPAC name is methyl 4-[2-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]ethoxy]benzoate.
| Compound Name | methyl 4-[2-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]ethoxy]benzoate |
|---|---|
| PubChem CID | 126616444 |
| Molecular Formula | C33H28Cl2N2O3 |
| Molecular Weight | 571.50 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | methyl 4-[2-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCn2c(C3CC3)nc3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc32)cc1 |
| InChI | InChI=1S/C33H28Cl2N2O3/c1-39-33(38)24-8-15-28(16-9-24)40-19-18-37-30-20-25(10-17-29(30)36-32(37)23-2-3-23)31(21-4-11-26(34)12-5-21)22-6-13-27(35)14-7-22/h4-17,20,23,31H,2-3,18-19H2,1H3 |
| InChIKey | FNBFUUGYOZROOG-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.50 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|