C30H28Cl2F3N3O3S — CID 126616250
4-[[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]methyl]-1-(trifluoromethylsulfonyl)piperidin-4-ol (PubChem CID 126616250) has the molecular formula C30H28Cl2F3N3O3S and a molecular weight of 638.54 g/mol. Its IUPAC name is 4-[[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]methyl]-1-(trifluoromethylsulfonyl)piperidin-4-ol.
| Compound Name | 4-[[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]methyl]-1-(trifluoromethylsulfonyl)piperidin-4-ol |
|---|---|
| PubChem CID | 126616250 |
| Molecular Formula | C30H28Cl2F3N3O3S |
| Molecular Weight | 638.54 g/mol |
| Exact Mass | 637.12 |
| IUPAC Name | 4-[[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]methyl]-1-(trifluoromethylsulfonyl)piperidin-4-ol |
| SMILES | O=S(=O)(N1CCC(O)(Cn2c(C3CC3)nc3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc32)CC1)C(F)(F)F |
| InChI | InChI=1S/C30H28Cl2F3N3O3S/c31-23-8-3-19(4-9-23)27(20-5-10-24(32)11-6-20)22-7-12-25-26(17-22)38(28(36-25)21-1-2-21)18-29(39)13-15-37(16-14-29)42(40,41)30(33,34)35/h3-12,17,21,27,39H,1-2,13-16,18H2 |
| InChIKey | PCJJUXSVLDKOHM-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.54 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|