C32H30Cl2F3N3O4S — CID 126616399
2,2-bis(4-chlorophenyl)-2-[2-cyclobutyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]benzimidazol-5-yl]acetic acid (PubChem CID 126616399) has the molecular formula C32H30Cl2F3N3O4S and a molecular weight of 680.58 g/mol. Its IUPAC name is 2,2-bis(4-chlorophenyl)-2-[2-cyclobutyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]benzimidazol-5-yl]acetic acid.
| Compound Name | 2,2-bis(4-chlorophenyl)-2-[2-cyclobutyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]benzimidazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 126616399 |
| Molecular Formula | C32H30Cl2F3N3O4S |
| Molecular Weight | 680.58 g/mol |
| Exact Mass | 679.13 |
| IUPAC Name | 2,2-bis(4-chlorophenyl)-2-[2-cyclobutyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]benzimidazol-5-yl]acetic acid |
| SMILES | O=C(O)C(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)c1ccc2nc(C3CCC3)n(CC3CCN(S(=O)(=O)C(F)(F)F)CC3)c2c1 |
| InChI | InChI=1S/C32H30Cl2F3N3O4S/c33-25-9-4-22(5-10-25)31(30(41)42,23-6-11-26(34)12-7-23)24-8-13-27-28(18-24)40(29(38-27)21-2-1-3-21)19-20-14-16-39(17-15-20)45(43,44)32(35,36)37/h4-13,18,20-21H,1-3,14-17,19H2,(H,41,42) |
| InChIKey | PZNHBKCZTRSDSZ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.58 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|