C38H33Cl2F4N3O4 — CID 172867461
5-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]-2-fluorobenzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 172867461) has the molecular formula C38H33Cl2F4N3O4 and a molecular weight of 742.60 g/mol. Its IUPAC name is 5-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]-2-fluorobenzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]-2-fluorobenzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 172867461 |
| Molecular Formula | C38H33Cl2F4N3O4 |
| Molecular Weight | 742.60 g/mol |
| Exact Mass | 741.18 |
| IUPAC Name | 5-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]-2-fluorobenzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)c1cc(CN2CCC(n3c(C4CC4)nc4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc43)CC2)ccc1F |
| InChI | InChI=1S/C36H32Cl2FN3O2.C2HF3O2/c37-27-9-4-23(5-10-27)34(24-6-11-28(38)12-7-24)26-8-14-32-33(20-26)42(35(40-32)25-2-3-25)29-15-17-41(18-16-29)21-22-1-13-31(39)30(19-22)36(43)44;3-2(4,5)1(6)7/h1,4-14,19-20,25,29,34H,2-3,15-18,21H2,(H,43,44);(H,6,7) |
| InChIKey | ADQPPNBZAITVOU-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.60 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|