C39H33Cl2N3O4S — CID 126616592
4-[3-[3-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]propylsulfamoyl]phenyl]benzoic acid (PubChem CID 126616592) has the molecular formula C39H33Cl2N3O4S and a molecular weight of 710.68 g/mol. Its IUPAC name is 4-[3-[3-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]propylsulfamoyl]phenyl]benzoic acid.
| Compound Name | 4-[3-[3-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]propylsulfamoyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 126616592 |
| Molecular Formula | C39H33Cl2N3O4S |
| Molecular Weight | 710.68 g/mol |
| Exact Mass | 709.16 |
| IUPAC Name | 4-[3-[3-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]propylsulfamoyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cccc(S(=O)(=O)NCCCn3c(C4CC4)nc4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc43)c2)cc1 |
| InChI | InChI=1S/C39H33Cl2N3O4S/c40-32-16-11-26(12-17-32)37(27-13-18-33(41)19-14-27)31-15-20-35-36(24-31)44(38(43-35)28-7-8-28)22-2-21-42-49(47,48)34-4-1-3-30(23-34)25-5-9-29(10-6-25)39(45)46/h1,3-6,9-20,23-24,28,37,42H,2,7-8,21-22H2,(H,45,46) |
| InChIKey | JHIVOWZWGVIDPY-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.68 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|