C34H30Cl2N4O4S — CID 126616697
6-[bis(4-chlorophenyl)methyl]-2-cyclopropyl-1-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]benzimidazole (PubChem CID 126616697) has the molecular formula C34H30Cl2N4O4S and a molecular weight of 661.61 g/mol. Its IUPAC name is 6-[bis(4-chlorophenyl)methyl]-2-cyclopropyl-1-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]benzimidazole.
| Compound Name | 6-[bis(4-chlorophenyl)methyl]-2-cyclopropyl-1-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]benzimidazole |
|---|---|
| PubChem CID | 126616697 |
| Molecular Formula | C34H30Cl2N4O4S |
| Molecular Weight | 661.61 g/mol |
| Exact Mass | 660.14 |
| IUPAC Name | 6-[bis(4-chlorophenyl)methyl]-2-cyclopropyl-1-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]benzimidazole |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)N2CCC(n3c(C4CC4)nc4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc43)CC2)c1 |
| InChI | InChI=1S/C34H30Cl2N4O4S/c35-26-11-6-22(7-12-26)33(23-8-13-27(36)14-9-23)25-10-15-31-32(20-25)39(34(37-31)24-4-5-24)28-16-18-38(19-17-28)45(43,44)30-3-1-2-29(21-30)40(41)42/h1-3,6-15,20-21,24,28,33H,4-5,16-19H2 |
| InChIKey | FMRDYCKPCFMDIR-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.61 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|