C34H32ClIN4O2S — CID 126639883
3-[4-[6-[(4-chlorophenyl)-(4-iodophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]sulfonylaniline (PubChem CID 126639883) has the molecular formula C34H32ClIN4O2S and a molecular weight of 723.08 g/mol. Its IUPAC name is 3-[4-[6-[(4-chlorophenyl)-(4-iodophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]sulfonylaniline.
| Compound Name | 3-[4-[6-[(4-chlorophenyl)-(4-iodophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]sulfonylaniline |
|---|---|
| PubChem CID | 126639883 |
| Molecular Formula | C34H32ClIN4O2S |
| Molecular Weight | 723.08 g/mol |
| Exact Mass | 722.10 |
| IUPAC Name | 3-[4-[6-[(4-chlorophenyl)-(4-iodophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]sulfonylaniline |
| SMILES | Nc1cccc(S(=O)(=O)N2CCC(n3c(C4CC4)nc4ccc(C(c5ccc(Cl)cc5)c5ccc(I)cc5)cc43)CC2)c1 |
| InChI | InChI=1S/C34H32ClIN4O2S/c35-26-11-6-22(7-12-26)33(23-8-13-27(36)14-9-23)25-10-15-31-32(20-25)40(34(38-31)24-4-5-24)29-16-18-39(19-17-29)43(41,42)30-3-1-2-28(37)21-30/h1-3,6-15,20-21,24,29,33H,4-5,16-19,37H2 |
| InChIKey | GUQXTJNDXOOHDT-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.08 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|