C38H37Cl2N5O5S — CID 126616345
methyl 3-[[5-[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]sulfonyl-2-pyridinyl]-formylamino]propanoate (PubChem CID 126616345) has the molecular formula C38H37Cl2N5O5S and a molecular weight of 746.72 g/mol. Its IUPAC name is methyl 3-[[5-[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]sulfonyl-2-pyridinyl]-formylamino]propanoate.
| Compound Name | methyl 3-[[5-[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]sulfonyl-2-pyridinyl]-formylamino]propanoate |
|---|---|
| PubChem CID | 126616345 |
| Molecular Formula | C38H37Cl2N5O5S |
| Molecular Weight | 746.72 g/mol |
| Exact Mass | 745.19 |
| IUPAC Name | methyl 3-[[5-[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]sulfonyl-2-pyridinyl]-formylamino]propanoate |
| SMILES | COC(=O)CCN(C=O)c1ccc(S(=O)(=O)N2CCC(n3c(C4CC4)nc4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc43)CC2)cn1 |
| InChI | InChI=1S/C38H37Cl2N5O5S/c1-50-36(47)18-19-43(24-46)35-15-13-32(23-41-35)51(48,49)44-20-16-31(17-21-44)45-34-22-28(8-14-33(34)42-38(45)27-2-3-27)37(25-4-9-29(39)10-5-25)26-6-11-30(40)12-7-26/h4-15,22-24,27,31,37H,2-3,16-21H2,1H3 |
| InChIKey | QLNYCPZCUMZOOD-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 114.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.72 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|