C35H31Cl2N3O2 — CID 126617173
4-[4-[5-[bis(4-chlorophenyl)methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]benzoic acid (PubChem CID 126617173) has the molecular formula C35H31Cl2N3O2 and a molecular weight of 596.56 g/mol. Its IUPAC name is 4-[4-[5-[bis(4-chlorophenyl)methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]benzoic acid.
| Compound Name | 4-[4-[5-[bis(4-chlorophenyl)methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 126617173 |
| Molecular Formula | C35H31Cl2N3O2 |
| Molecular Weight | 596.56 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | 4-[4-[5-[bis(4-chlorophenyl)methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCC(c3nn(C4CC4)c4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc34)CC2)cc1 |
| InChI | InChI=1S/C35H31Cl2N3O2/c36-27-8-1-22(2-9-27)33(23-3-10-28(37)11-4-23)26-7-16-32-31(21-26)34(38-40(32)30-14-15-30)24-17-19-39(20-18-24)29-12-5-25(6-13-29)35(41)42/h1-13,16,21,24,30,33H,14-15,17-20H2,(H,41,42) |
| InChIKey | ZCNZLIAPTGMNBK-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.56 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|