C37H36Cl2N4O4S — CID 126617219
4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonyl-2-methoxy-N-methylbenzamide (PubChem CID 126617219) has the molecular formula C37H36Cl2N4O4S and a molecular weight of 703.69 g/mol. Its IUPAC name is 4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonyl-2-methoxy-N-methylbenzamide.
| Compound Name | 4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonyl-2-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 126617219 |
| Molecular Formula | C37H36Cl2N4O4S |
| Molecular Weight | 703.69 g/mol |
| Exact Mass | 702.18 |
| IUPAC Name | 4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonyl-2-methoxy-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(S(=O)(=O)N2CCC(c3c4cc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)ccc4nn3C3CC3)CC2)cc1OC |
| InChI | InChI=1S/C37H36Cl2N4O4S/c1-40-37(44)31-15-14-30(22-34(31)47-2)48(45,46)42-19-17-25(18-20-42)36-32-21-26(7-16-33(32)41-43(36)29-12-13-29)35(23-3-8-27(38)9-4-23)24-5-10-28(39)11-6-24/h3-11,14-16,21-22,25,29,35H,12-13,17-20H2,1-2H3,(H,40,44) |
| InChIKey | AGFWCFSZHJHACI-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.69 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|