C36H34Cl2N4O4S — CID 126617218
5-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonyl-2-methoxybenzamide (PubChem CID 126617218) has the molecular formula C36H34Cl2N4O4S and a molecular weight of 689.67 g/mol. Its IUPAC name is 5-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonyl-2-methoxybenzamide.
| Compound Name | 5-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonyl-2-methoxybenzamide |
|---|---|
| PubChem CID | 126617218 |
| Molecular Formula | C36H34Cl2N4O4S |
| Molecular Weight | 689.67 g/mol |
| Exact Mass | 688.17 |
| IUPAC Name | 5-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonyl-2-methoxybenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(c3c4cc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)ccc4nn3C3CC3)CC2)cc1C(N)=O |
| InChI | InChI=1S/C36H34Cl2N4O4S/c1-46-33-15-13-29(21-31(33)36(39)43)47(44,45)41-18-16-24(17-19-41)35-30-20-25(6-14-32(30)40-42(35)28-11-12-28)34(22-2-7-26(37)8-3-22)23-4-9-27(38)10-5-23/h2-10,13-15,20-21,24,28,34H,11-12,16-19H2,1H3,(H2,39,43) |
| InChIKey | XFXNKNOCNSQNOS-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.67 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|