C34H35Cl2N3O3 — CID 126617203
ethyl 4-[4-[5-[bis(4-chlorophenyl)methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]-4-oxobutanoate (PubChem CID 126617203) has the molecular formula C34H35Cl2N3O3 and a molecular weight of 604.58 g/mol. Its IUPAC name is ethyl 4-[4-[5-[bis(4-chlorophenyl)methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]-4-oxobutanoate.
| Compound Name | ethyl 4-[4-[5-[bis(4-chlorophenyl)methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 126617203 |
| Molecular Formula | C34H35Cl2N3O3 |
| Molecular Weight | 604.58 g/mol |
| Exact Mass | 603.21 |
| IUPAC Name | ethyl 4-[4-[5-[bis(4-chlorophenyl)methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N1CCC(c2nn(C3CC3)c3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc23)CC1 |
| InChI | InChI=1S/C34H35Cl2N3O3/c1-2-42-32(41)16-15-31(40)38-19-17-24(18-20-38)34-29-21-25(7-14-30(29)39(37-34)28-12-13-28)33(22-3-8-26(35)9-4-22)23-5-10-27(36)11-6-23/h3-11,14,21,24,28,33H,2,12-13,15-20H2,1H3 |
| InChIKey | YQEACWQXECIZKO-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.58 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|