C25H30N2O4 — CID 108559440
ethyl 4-[4-[(2,2-diphenylacetyl)amino]piperidin-1-yl]-4-oxobutanoate (PubChem CID 108559440) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is ethyl 4-[4-[(2,2-diphenylacetyl)amino]piperidin-1-yl]-4-oxobutanoate.
| Compound Name | ethyl 4-[4-[(2,2-diphenylacetyl)amino]piperidin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 108559440 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | ethyl 4-[4-[(2,2-diphenylacetyl)amino]piperidin-1-yl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N1CCC(NC(=O)C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H30N2O4/c1-2-31-23(29)14-13-22(28)27-17-15-21(16-18-27)26-25(30)24(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,21,24H,2,13-18H2,1H3,(H,26,30) |
| InChIKey | SVAYZOJJJHZZNT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |