C20H29N3O4 — CID 108562813
ethyl 4-[4-[[4-(dimethylamino)benzoyl]amino]piperidin-1-yl]-4-oxobutanoate (PubChem CID 108562813) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is ethyl 4-[4-[[4-(dimethylamino)benzoyl]amino]piperidin-1-yl]-4-oxobutanoate.
| Compound Name | ethyl 4-[4-[[4-(dimethylamino)benzoyl]amino]piperidin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 108562813 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | ethyl 4-[4-[[4-(dimethylamino)benzoyl]amino]piperidin-1-yl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N1CCC(NC(=O)c2ccc(N(C)C)cc2)CC1 |
| InChI | InChI=1S/C20H29N3O4/c1-4-27-19(25)10-9-18(24)23-13-11-16(12-14-23)21-20(26)15-5-7-17(8-6-15)22(2)3/h5-8,16H,4,9-14H2,1-3H3,(H,21,26) |
| InChIKey | XRGPTVTUAGPXBX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |