C14H10Cl2N6O2 — CID 154640795
2-[2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-5-methyl-8H-pteridine-6,7-dione (PubChem CID 154640795) has the molecular formula C14H10Cl2N6O2 and a molecular weight of 365.18 g/mol. Its IUPAC name is 2-[2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-5-methyl-8H-pteridine-6,7-dione.
| Compound Name | 2-[2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-5-methyl-8H-pteridine-6,7-dione |
|---|---|
| PubChem CID | 154640795 |
| Molecular Formula | C14H10Cl2N6O2 |
| Molecular Weight | 365.18 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 2-[2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-5-methyl-8H-pteridine-6,7-dione |
| SMILES | Cn1c(=O)c(=O)[nH]c2nc(NN=Cc3cccc(Cl)c3Cl)ncc21 |
| InChI | InChI=1S/C14H10Cl2N6O2/c1-22-9-6-17-14(20-11(9)19-12(23)13(22)24)21-18-5-7-3-2-4-8(15)10(7)16/h2-6H,1H3,(H2,17,19,20,21,23) |
| InChIKey | QYKPXEAHZGEKRX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.18 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|