C20H27N7O3 — CID 177341126
8-[(9-cyclopentyl-7-methyl-8-oxopurin-2-yl)amino]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 177341126) has the molecular formula C20H27N7O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 8-[(9-cyclopentyl-7-methyl-8-oxopurin-2-yl)amino]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[(9-cyclopentyl-7-methyl-8-oxopurin-2-yl)amino]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 177341126 |
| Molecular Formula | C20H27N7O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 8-[(9-cyclopentyl-7-methyl-8-oxopurin-2-yl)amino]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1C(=O)NC(=O)C12CCC(Nc1ncc3c(n1)n(C1CCCC1)c(=O)n3C)CC2 |
| InChI | InChI=1S/C20H27N7O3/c1-25-14-11-21-17(23-15(14)27(19(25)30)13-5-3-4-6-13)22-12-7-9-20(10-8-12)16(28)24-18(29)26(20)2/h11-13H,3-10H2,1-2H3,(H,21,22,23)(H,24,28,29) |
| InChIKey | JGLGVMFORBQOCI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|