C24H32N6O2 — CID 67159329
9-cyclopentyl-2-[2-methoxy-4-(1-methylpiperidin-4-yl)anilino]-7-methylpurin-8-one (PubChem CID 67159329) has the molecular formula C24H32N6O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 9-cyclopentyl-2-[2-methoxy-4-(1-methylpiperidin-4-yl)anilino]-7-methylpurin-8-one.
| Compound Name | 9-cyclopentyl-2-[2-methoxy-4-(1-methylpiperidin-4-yl)anilino]-7-methylpurin-8-one |
|---|---|
| PubChem CID | 67159329 |
| Molecular Formula | C24H32N6O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 9-cyclopentyl-2-[2-methoxy-4-(1-methylpiperidin-4-yl)anilino]-7-methylpurin-8-one |
| SMILES | COc1cc(C2CCN(C)CC2)ccc1Nc1ncc2c(n1)n(C1CCCC1)c(=O)n2C |
| InChI | InChI=1S/C24H32N6O2/c1-28-12-10-16(11-13-28)17-8-9-19(21(14-17)32-3)26-23-25-15-20-22(27-23)30(24(31)29(20)2)18-6-4-5-7-18/h8-9,14-16,18H,4-7,10-13H2,1-3H3,(H,25,26,27) |
| InChIKey | WKYGSBYKLRSPRP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |