C21H25N6O3+ — CID 58608843
4-[(8-cyclopentyl-5,6-dimethyl-7-oxopteridin-5-ium-2-yl)amino]-3-methoxybenzamide (PubChem CID 58608843) has the molecular formula C21H25N6O3+ and a molecular weight of 409.47 g/mol. Its IUPAC name is 4-[(8-cyclopentyl-5,6-dimethyl-7-oxopteridin-5-ium-2-yl)amino]-3-methoxybenzamide.
| Compound Name | 4-[(8-cyclopentyl-5,6-dimethyl-7-oxopteridin-5-ium-2-yl)amino]-3-methoxybenzamide |
|---|---|
| PubChem CID | 58608843 |
| Molecular Formula | C21H25N6O3+ |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 4-[(8-cyclopentyl-5,6-dimethyl-7-oxopteridin-5-ium-2-yl)amino]-3-methoxybenzamide |
| SMILES | COc1cc(C(N)=O)ccc1Nc1ncc2c(n1)n(C1CCCC1)c(=O)c(C)[n+]2C |
| InChI | InChI=1S/C21H24N6O3/c1-12-20(29)27(14-6-4-5-7-14)19-16(26(12)2)11-23-21(25-19)24-15-9-8-13(18(22)28)10-17(15)30-3/h8-11,14H,4-7H2,1-3H3,(H2-,22,23,24,25,28,29)/p+1 |
| InChIKey | XXXYSEUYNMUGNM-UHFFFAOYSA-O |
| XLogP | 1.89 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|