C24H33N7O3 — CID 67159076
4-[(9-cyclopentyl-7-methyl-8-oxopurin-2-yl)amino]-N-[3-(dimethylamino)propyl]-3-methoxybenzamide (PubChem CID 67159076) has the molecular formula C24H33N7O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 4-[(9-cyclopentyl-7-methyl-8-oxopurin-2-yl)amino]-N-[3-(dimethylamino)propyl]-3-methoxybenzamide.
| Compound Name | 4-[(9-cyclopentyl-7-methyl-8-oxopurin-2-yl)amino]-N-[3-(dimethylamino)propyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 67159076 |
| Molecular Formula | C24H33N7O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 4-[(9-cyclopentyl-7-methyl-8-oxopurin-2-yl)amino]-N-[3-(dimethylamino)propyl]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCCCN(C)C)ccc1Nc1ncc2c(n1)n(C1CCCC1)c(=O)n2C |
| InChI | InChI=1S/C24H33N7O3/c1-29(2)13-7-12-25-22(32)16-10-11-18(20(14-16)34-4)27-23-26-15-19-21(28-23)31(24(33)30(19)3)17-8-5-6-9-17/h10-11,14-15,17H,5-9,12-13H2,1-4H3,(H,25,32)(H,26,27,28) |
| InChIKey | KAMZWBAQFQVHRK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|