C26H34N6O4 — CID 66746048
4-[(2-cyclopentyl-9-methyl-8-oxo-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),10,12-trien-13-yl)amino]-N-(2-hydroxyethyl)-3-methoxybenzamide (PubChem CID 66746048) has the molecular formula C26H34N6O4 and a molecular weight of 494.60 g/mol. Its IUPAC name is 4-[(2-cyclopentyl-9-methyl-8-oxo-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),10,12-trien-13-yl)amino]-N-(2-hydroxyethyl)-3-methoxybenzamide.
| Compound Name | 4-[(2-cyclopentyl-9-methyl-8-oxo-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),10,12-trien-13-yl)amino]-N-(2-hydroxyethyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 66746048 |
| Molecular Formula | C26H34N6O4 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 4-[(2-cyclopentyl-9-methyl-8-oxo-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),10,12-trien-13-yl)amino]-N-(2-hydroxyethyl)-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCCO)ccc1Nc1ncc2c(n1)N(C1CCCC1)C1CCCC1C(=O)N2C |
| InChI | InChI=1S/C26H34N6O4/c1-31-21-15-28-26(29-19-11-10-16(14-22(19)36-2)24(34)27-12-13-33)30-23(21)32(17-6-3-4-7-17)20-9-5-8-18(20)25(31)35/h10-11,14-15,17-18,20,33H,3-9,12-13H2,1-2H3,(H,27,34)(H,28,29,30) |
| InChIKey | QIPVZWHYZOJQIX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |