C33H49N7O5 — CID 171081470
4-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxy-N-[2-(4-piperidin-4-yloxybutoxy)ethyl]benzamide (PubChem CID 171081470) has the molecular formula C33H49N7O5 and a molecular weight of 623.80 g/mol. Its IUPAC name is 4-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxy-N-[2-(4-piperidin-4-yloxybutoxy)ethyl]benzamide.
| Compound Name | 4-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxy-N-[2-(4-piperidin-4-yloxybutoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 171081470 |
| Molecular Formula | C33H49N7O5 |
| Molecular Weight | 623.80 g/mol |
| Exact Mass | 623.38 |
| IUPAC Name | 4-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxy-N-[2-(4-piperidin-4-yloxybutoxy)ethyl]benzamide |
| SMILES | CC[C@@H]1C(=O)N(C)c2cnc(Nc3ccc(C(=O)NCCOCCCCOC4CCNCC4)cc3OC)nc2N1C1CCCC1 |
| InChI | InChI=1S/C33H49N7O5/c1-4-27-32(42)39(2)28-22-36-33(38-30(28)40(27)24-9-5-6-10-24)37-26-12-11-23(21-29(26)43-3)31(41)35-17-20-44-18-7-8-19-45-25-13-15-34-16-14-25/h11-12,21-22,24-25,27,34H,4-10,13-20H2,1-3H3,(H,35,41)(H,36,37,38)/t27-/m1/s1 |
| InChIKey | XSZMNTNFKREHHY-HHHXNRCGSA-N |
| XLogP | 4.03 |
| TPSA | 130.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.80 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|