C29H43N7O3 — CID 171081775
4-[(8-cyclopentyl-7-ethyl-5-methyl-6,7-dihydropteridin-2-yl)amino]-3-methoxy-N-(2-piperidin-4-yloxyethyl)benzamide (PubChem CID 171081775) has the molecular formula C29H43N7O3 and a molecular weight of 537.71 g/mol. Its IUPAC name is 4-[(8-cyclopentyl-7-ethyl-5-methyl-6,7-dihydropteridin-2-yl)amino]-3-methoxy-N-(2-piperidin-4-yloxyethyl)benzamide.
| Compound Name | 4-[(8-cyclopentyl-7-ethyl-5-methyl-6,7-dihydropteridin-2-yl)amino]-3-methoxy-N-(2-piperidin-4-yloxyethyl)benzamide |
|---|---|
| PubChem CID | 171081775 |
| Molecular Formula | C29H43N7O3 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.34 |
| IUPAC Name | 4-[(8-cyclopentyl-7-ethyl-5-methyl-6,7-dihydropteridin-2-yl)amino]-3-methoxy-N-(2-piperidin-4-yloxyethyl)benzamide |
| SMILES | CCC1CN(C)c2cnc(Nc3ccc(C(=O)NCCOC4CCNCC4)cc3OC)nc2N1C1CCCC1 |
| InChI | InChI=1S/C29H43N7O3/c1-4-21-19-35(2)25-18-32-29(34-27(25)36(21)22-7-5-6-8-22)33-24-10-9-20(17-26(24)38-3)28(37)31-15-16-39-23-11-13-30-14-12-23/h9-10,17-18,21-23,30H,4-8,11-16,19H2,1-3H3,(H,31,37)(H,32,33,34) |
| InChIKey | WEVQAWWFDULQPJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|