C28H37N7O3 — CID 171081944
(7R)-2-[4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-2-methoxyanilino]-8-cyclopentyl-7-ethyl-5-methyl-7H-pteridin-6-one (PubChem CID 171081944) has the molecular formula C28H37N7O3 and a molecular weight of 519.65 g/mol. Its IUPAC name is (7R)-2-[4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-2-methoxyanilino]-8-cyclopentyl-7-ethyl-5-methyl-7H-pteridin-6-one.
| Compound Name | (7R)-2-[4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-2-methoxyanilino]-8-cyclopentyl-7-ethyl-5-methyl-7H-pteridin-6-one |
|---|---|
| PubChem CID | 171081944 |
| Molecular Formula | C28H37N7O3 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | (7R)-2-[4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-2-methoxyanilino]-8-cyclopentyl-7-ethyl-5-methyl-7H-pteridin-6-one |
| SMILES | CC[C@@H]1C(=O)N(C)c2cnc(Nc3ccc(C(=O)N4CC5CNCC5C4)cc3OC)nc2N1C1CCCC1 |
| InChI | InChI=1S/C28H37N7O3/c1-4-22-27(37)33(2)23-14-30-28(32-25(23)35(22)20-7-5-6-8-20)31-21-10-9-17(11-24(21)38-3)26(36)34-15-18-12-29-13-19(18)16-34/h9-11,14,18-20,22,29H,4-8,12-13,15-16H2,1-3H3,(H,30,31,32)/t18?,19?,22-/m1/s1 |
| InChIKey | AFCJBDVKBZGORS-OBFZPWGMSA-N |
| XLogP | 3.02 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |