C25H35N5O2 — CID 171081046
(7R)-2-(4-butan-2-yl-2-methoxyanilino)-8-cyclopentyl-7-ethyl-5-methyl-7H-pteridin-6-one (PubChem CID 171081046) has the molecular formula C25H35N5O2 and a molecular weight of 437.59 g/mol. Its IUPAC name is (7R)-2-(4-butan-2-yl-2-methoxyanilino)-8-cyclopentyl-7-ethyl-5-methyl-7H-pteridin-6-one.
| Compound Name | (7R)-2-(4-butan-2-yl-2-methoxyanilino)-8-cyclopentyl-7-ethyl-5-methyl-7H-pteridin-6-one |
|---|---|
| PubChem CID | 171081046 |
| Molecular Formula | C25H35N5O2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | (7R)-2-(4-butan-2-yl-2-methoxyanilino)-8-cyclopentyl-7-ethyl-5-methyl-7H-pteridin-6-one |
| SMILES | CCC(C)c1ccc(Nc2ncc3c(n2)N(C2CCCC2)[C@H](CC)C(=O)N3C)c(OC)c1 |
| InChI | InChI=1S/C25H35N5O2/c1-6-16(3)17-12-13-19(22(14-17)32-5)27-25-26-15-21-23(28-25)30(18-10-8-9-11-18)20(7-2)24(31)29(21)4/h12-16,18,20H,6-11H2,1-5H3,(H,26,27,28)/t16?,20-/m1/s1 |
| InChIKey | DQJLEFAWGKCKSI-OTOKDRCRSA-N |
| XLogP | 5.25 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |