C28H39N7O5 — CID 66670431
(2S)-6-amino-2-[[4-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxybenzoyl]amino]hexanoic acid (PubChem CID 66670431) has the molecular formula C28H39N7O5 and a molecular weight of 553.66 g/mol. Its IUPAC name is (2S)-6-amino-2-[[4-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxybenzoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[4-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxybenzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 66670431 |
| Molecular Formula | C28H39N7O5 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | (2S)-6-amino-2-[[4-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxybenzoyl]amino]hexanoic acid |
| SMILES | CC[C@@H]1C(=O)N(C)c2cnc(Nc3ccc(C(=O)N[C@@H](CCCCN)C(=O)O)cc3OC)nc2N1C1CCCC1 |
| InChI | InChI=1S/C28H39N7O5/c1-4-21-26(37)34(2)22-16-30-28(33-24(22)35(21)18-9-5-6-10-18)32-19-13-12-17(15-23(19)40-3)25(36)31-20(27(38)39)11-7-8-14-29/h12-13,15-16,18,20-21H,4-11,14,29H2,1-3H3,(H,31,36)(H,38,39)(H,30,32,33)/t20-,21+/m0/s1 |
| InChIKey | IYKOYCYQTNCZCB-LEWJYISDSA-N |
| XLogP | 3.04 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|