C36H50N8O5 — CID 66670576
(2S)-2-(cyclopentylamino)-4-[6-[[4-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxybenzoyl]amino]-3-azabicyclo[3.1.0]hexan-3-yl]butanoic acid (PubChem CID 66670576) has the molecular formula C36H50N8O5 and a molecular weight of 674.85 g/mol. Its IUPAC name is (2S)-2-(cyclopentylamino)-4-[6-[[4-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxybenzoyl]amino]-3-azabicyclo[3.1.0]hexan-3-yl]butanoic acid.
| Compound Name | (2S)-2-(cyclopentylamino)-4-[6-[[4-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxybenzoyl]amino]-3-azabicyclo[3.1.0]hexan-3-yl]butanoic acid |
|---|---|
| PubChem CID | 66670576 |
| Molecular Formula | C36H50N8O5 |
| Molecular Weight | 674.85 g/mol |
| Exact Mass | 674.39 |
| IUPAC Name | (2S)-2-(cyclopentylamino)-4-[6-[[4-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxybenzoyl]amino]-3-azabicyclo[3.1.0]hexan-3-yl]butanoic acid |
| SMILES | CC[C@@H]1C(=O)N(C)c2cnc(Nc3ccc(C(=O)NC4C5CN(CC[C@H](NC6CCCC6)C(=O)O)CC54)cc3OC)nc2N1C1CCCC1 |
| InChI | InChI=1S/C36H50N8O5/c1-4-28-34(46)42(2)29-18-37-36(41-32(29)44(28)23-11-7-8-12-23)39-26-14-13-21(17-30(26)49-3)33(45)40-31-24-19-43(20-25(24)31)16-15-27(35(47)48)38-22-9-5-6-10-22/h13-14,17-18,22-25,27-28,31,38H,4-12,15-16,19-20H2,1-3H3,(H,40,45)(H,47,48)(H,37,39,41)/t24?,25?,27-,28+,31?/m0/s1 |
| InChIKey | COKDJYGPENSTKX-KVEQCLBHSA-N |
| XLogP | 3.77 |
| TPSA | 152.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.85 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |