C32H47N7O4 — CID 175989126
2-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxy-N-(5-piperidin-4-yloxypentyl)benzamide (PubChem CID 175989126) has the molecular formula C32H47N7O4 and a molecular weight of 593.77 g/mol. Its IUPAC name is 2-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxy-N-(5-piperidin-4-yloxypentyl)benzamide.
| Compound Name | 2-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxy-N-(5-piperidin-4-yloxypentyl)benzamide |
|---|---|
| PubChem CID | 175989126 |
| Molecular Formula | C32H47N7O4 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.37 |
| IUPAC Name | 2-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxy-N-(5-piperidin-4-yloxypentyl)benzamide |
| SMILES | CC[C@@H]1C(=O)N(C)c2cnc(Nc3c(OC)cccc3C(=O)NCCCCCOC3CCNCC3)nc2N1C1CCCC1 |
| InChI | InChI=1S/C32H47N7O4/c1-4-25-31(41)38(2)26-21-35-32(37-29(26)39(25)22-11-6-7-12-22)36-28-24(13-10-14-27(28)42-3)30(40)34-17-8-5-9-20-43-23-15-18-33-19-16-23/h10,13-14,21-23,25,33H,4-9,11-12,15-20H2,1-3H3,(H,34,40)(H,35,36,37)/t25-/m1/s1 |
| InChIKey | LTNZBZUDLGZUAW-RUZDIDTESA-N |
| XLogP | 4.40 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|