C25H32N6O3 — CID 68992962
4-[[(3S,7R)-2-cyclopentyl-9-methyl-8-oxo-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),10,12-trien-13-yl]amino]-3-methoxy-N-methylbenzamide (PubChem CID 68992962) has the molecular formula C25H32N6O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is 4-[[(3S,7R)-2-cyclopentyl-9-methyl-8-oxo-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),10,12-trien-13-yl]amino]-3-methoxy-N-methylbenzamide.
| Compound Name | 4-[[(3S,7R)-2-cyclopentyl-9-methyl-8-oxo-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),10,12-trien-13-yl]amino]-3-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 68992962 |
| Molecular Formula | C25H32N6O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 4-[[(3S,7R)-2-cyclopentyl-9-methyl-8-oxo-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),10,12-trien-13-yl]amino]-3-methoxy-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(Nc2ncc3c(n2)N(C2CCCC2)[C@H]2CCC[C@H]2C(=O)N3C)c(OC)c1 |
| InChI | InChI=1S/C25H32N6O3/c1-26-23(32)15-11-12-18(21(13-15)34-3)28-25-27-14-20-22(29-25)31(16-7-4-5-8-16)19-10-6-9-17(19)24(33)30(20)2/h11-14,16-17,19H,4-10H2,1-3H3,(H,26,32)(H,27,28,29)/t17-,19+/m1/s1 |
| InChIKey | XBWVKVCSCJYKTP-MJGOQNOKSA-N |
| XLogP | 3.48 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |