C14H17ClN4O2 — CID 156565107
2-chloro-7-methyl-9-(2-oxaspiro[3.5]nonan-7-yl)purin-8-one (PubChem CID 156565107) has the molecular formula C14H17ClN4O2 and a molecular weight of 308.77 g/mol. Its IUPAC name is 2-chloro-7-methyl-9-(2-oxaspiro[3.5]nonan-7-yl)purin-8-one.
| Compound Name | 2-chloro-7-methyl-9-(2-oxaspiro[3.5]nonan-7-yl)purin-8-one |
|---|---|
| PubChem CID | 156565107 |
| Molecular Formula | C14H17ClN4O2 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-chloro-7-methyl-9-(2-oxaspiro[3.5]nonan-7-yl)purin-8-one |
| SMILES | Cn1c(=O)n(C2CCC3(CC2)COC3)c2nc(Cl)ncc21 |
| InChI | InChI=1S/C14H17ClN4O2/c1-18-10-6-16-12(15)17-11(10)19(13(18)20)9-2-4-14(5-3-9)7-21-8-14/h6,9H,2-5,7-8H2,1H3 |
| InChIKey | MYLNILZTGBSQMR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |