C12H12ClN5O2 — CID 162680307
2-[2-chloro-9-(oxan-4-yl)-8-oxopurin-7-yl]acetonitrile (PubChem CID 162680307) has the molecular formula C12H12ClN5O2 and a molecular weight of 293.71 g/mol. Its IUPAC name is 2-[2-chloro-9-(oxan-4-yl)-8-oxopurin-7-yl]acetonitrile.
| Compound Name | 2-[2-chloro-9-(oxan-4-yl)-8-oxopurin-7-yl]acetonitrile |
|---|---|
| PubChem CID | 162680307 |
| Molecular Formula | C12H12ClN5O2 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-[2-chloro-9-(oxan-4-yl)-8-oxopurin-7-yl]acetonitrile |
| SMILES | N#CCn1c(=O)n(C2CCOCC2)c2nc(Cl)ncc21 |
| InChI | InChI=1S/C12H12ClN5O2/c13-11-15-7-9-10(16-11)18(8-1-5-20-6-2-8)12(19)17(9)4-3-14/h7-8H,1-2,4-6H2 |
| InChIKey | MBPAOXNNKGHDCY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 85.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |