C12H11ClN4OS — CID 156894891
10-chloro-7-(oxan-4-yl)-5-thia-4,7,9,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),3,8,10-pentaene (PubChem CID 156894891) has the molecular formula C12H11ClN4OS and a molecular weight of 294.77 g/mol. Its IUPAC name is 10-chloro-7-(oxan-4-yl)-5-thia-4,7,9,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),3,8,10-pentaene.
| Compound Name | 10-chloro-7-(oxan-4-yl)-5-thia-4,7,9,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),3,8,10-pentaene |
|---|---|
| PubChem CID | 156894891 |
| Molecular Formula | C12H11ClN4OS |
| Molecular Weight | 294.77 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 10-chloro-7-(oxan-4-yl)-5-thia-4,7,9,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),3,8,10-pentaene |
| SMILES | Clc1ncc2c3cnsc3n(C3CCOCC3)c2n1 |
| InChI | InChI=1S/C12H11ClN4OS/c13-12-14-5-8-9-6-15-19-11(9)17(10(8)16-12)7-1-3-18-4-2-7/h5-7H,1-4H2 |
| InChIKey | RSYZHNIDXQAUIH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.77 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |