C10H13ClN4O — CID 141313293
2-chloro-9-(oxan-4-yl)-7,8-dihydropurine (PubChem CID 141313293) has the molecular formula C10H13ClN4O and a molecular weight of 240.69 g/mol. Its IUPAC name is 2-chloro-9-(oxan-4-yl)-7,8-dihydropurine.
| Compound Name | 2-chloro-9-(oxan-4-yl)-7,8-dihydropurine |
|---|---|
| PubChem CID | 141313293 |
| Molecular Formula | C10H13ClN4O |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-chloro-9-(oxan-4-yl)-7,8-dihydropurine |
| SMILES | Clc1ncc2c(n1)N(C1CCOCC1)CN2 |
| InChI | InChI=1S/C10H13ClN4O/c11-10-12-5-8-9(14-10)15(6-13-8)7-1-3-16-4-2-7/h5,7,13H,1-4,6H2 |
| InChIKey | XEMLGHCKZFVAJU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |